C23H30F3N5O2S — CID 126565823
(3aS,6aS)-5-[3-[[5-[(2S)-1,4-dioxan-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole (PubChem CID 126565823) has the molecular formula C23H30F3N5O2S and a molecular weight of 497.59 g/mol. Its IUPAC name is (3aS,6aS)-5-[3-[[5-[(2S)-1,4-dioxan-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole.
| Compound Name | (3aS,6aS)-5-[3-[[5-[(2S)-1,4-dioxan-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 126565823 |
| Molecular Formula | C23H30F3N5O2S |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | (3aS,6aS)-5-[3-[[5-[(2S)-1,4-dioxan-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
| SMILES | Cn1c(SCCCN2C[C@@H]3CCN(c4ccc(C(F)(F)F)cc4)[C@@H]3C2)nnc1[C@H]1COCCO1 |
| InChI | InChI=1S/C23H30F3N5O2S/c1-29-21(20-15-32-10-11-33-20)27-28-22(29)34-12-2-8-30-13-16-7-9-31(19(16)14-30)18-5-3-17(4-6-18)23(24,25)26/h3-6,16,19-20H,2,7-15H2,1H3/t16-,19+,20+/m0/s1 |
| InChIKey | GFXGGKFVAYIGGO-PWIZWCRZSA-N |
| XLogP | 3.61 |
| TPSA | 55.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|