C25H30F3N7S — CID 126566262
(3aS,6aS)-3a,6a-dimethyl-5-[3-[(4-methyl-5-pyrimidin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-2,3,4,6-tetrahydropyrrolo[2,3-c]pyrrole (PubChem CID 126566262) has the molecular formula C25H30F3N7S and a molecular weight of 517.63 g/mol. Its IUPAC name is (3aS,6aS)-3a,6a-dimethyl-5-[3-[(4-methyl-5-pyrimidin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-2,3,4,6-tetrahydropyrrolo[2,3-c]pyrrole.
| Compound Name | (3aS,6aS)-3a,6a-dimethyl-5-[3-[(4-methyl-5-pyrimidin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-2,3,4,6-tetrahydropyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 126566262 |
| Molecular Formula | C25H30F3N7S |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | (3aS,6aS)-3a,6a-dimethyl-5-[3-[(4-methyl-5-pyrimidin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-2,3,4,6-tetrahydropyrrolo[2,3-c]pyrrole |
| SMILES | Cn1c(SCCCN2C[C@]3(C)CCN(c4ccc(C(F)(F)F)cc4)[C@]3(C)C2)nnc1-c1ccncn1 |
| InChI | InChI=1S/C25H30F3N7S/c1-23-10-13-35(19-7-5-18(6-8-19)25(26,27)28)24(23,2)16-34(15-23)12-4-14-36-22-32-31-21(33(22)3)20-9-11-29-17-30-20/h5-9,11,17H,4,10,12-16H2,1-3H3/t23-,24+/m0/s1 |
| InChIKey | PGVMPMFLYTXXHW-BJKOFHAPSA-N |
| XLogP | 4.76 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|