C24H28F3N7S — CID 126565886
(3aR,6aR)-3a-methyl-5-[3-[(4-methyl-5-pyrazin-2-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole (PubChem CID 126565886) has the molecular formula C24H28F3N7S and a molecular weight of 503.60 g/mol. Its IUPAC name is (3aR,6aR)-3a-methyl-5-[3-[(4-methyl-5-pyrazin-2-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole.
| Compound Name | (3aR,6aR)-3a-methyl-5-[3-[(4-methyl-5-pyrazin-2-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 126565886 |
| Molecular Formula | C24H28F3N7S |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | (3aR,6aR)-3a-methyl-5-[3-[(4-methyl-5-pyrazin-2-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole |
| SMILES | Cn1c(SCCCN2C[C@@H]3N(c4ccc(C(F)(F)F)cc4)CC[C@]3(C)C2)nnc1-c1cnccn1 |
| InChI | InChI=1S/C24H28F3N7S/c1-23-8-12-34(18-6-4-17(5-7-18)24(25,26)27)20(23)15-33(16-23)11-3-13-35-22-31-30-21(32(22)2)19-14-28-9-10-29-19/h4-7,9-10,14,20H,3,8,11-13,15-16H2,1-2H3/t20-,23+/m0/s1 |
| InChIKey | OAMVLCIHWHLFKY-NZQKXSOJSA-N |
| XLogP | 4.37 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|