C24H29F3N6OS — CID 126566230
5-[5-[3-[(3aR,6aR)-3a-methyl-1-[4-(trifluoromethyl)phenyl]-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-4-methyl-1,3-oxazole (PubChem CID 126566230) has the molecular formula C24H29F3N6OS and a molecular weight of 506.60 g/mol. Its IUPAC name is 5-[5-[3-[(3aR,6aR)-3a-methyl-1-[4-(trifluoromethyl)phenyl]-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-4-methyl-1,3-oxazole.
| Compound Name | 5-[5-[3-[(3aR,6aR)-3a-methyl-1-[4-(trifluoromethyl)phenyl]-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-4-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 126566230 |
| Molecular Formula | C24H29F3N6OS |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 5-[5-[3-[(3aR,6aR)-3a-methyl-1-[4-(trifluoromethyl)phenyl]-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-4-methyl-1,3-oxazole |
| SMILES | Cc1ncoc1-c1nnc(SCCCN2C[C@@H]3N(c4ccc(C(F)(F)F)cc4)CC[C@]3(C)C2)n1C |
| InChI | InChI=1S/C24H29F3N6OS/c1-16-20(34-15-28-16)21-29-30-22(31(21)3)35-12-4-10-32-13-19-23(2,14-32)9-11-33(19)18-7-5-17(6-8-18)24(25,26)27/h5-8,15,19H,4,9-14H2,1-3H3/t19-,23+/m0/s1 |
| InChIKey | WXONAUQOJIYGOV-WMZHIEFXSA-N |
| XLogP | 4.88 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|