C24H35N5OS — CID 126570455
(3aS,6aS)-3a-methyl-5-[3-[[4-methyl-5-(oxan-4-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-1-phenyl-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole (PubChem CID 126570455) has the molecular formula C24H35N5OS and a molecular weight of 441.65 g/mol. Its IUPAC name is (3aS,6aS)-3a-methyl-5-[3-[[4-methyl-5-(oxan-4-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-1-phenyl-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole.
| Compound Name | (3aS,6aS)-3a-methyl-5-[3-[[4-methyl-5-(oxan-4-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-1-phenyl-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 126570455 |
| Molecular Formula | C24H35N5OS |
| Molecular Weight | 441.65 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | (3aS,6aS)-3a-methyl-5-[3-[[4-methyl-5-(oxan-4-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-1-phenyl-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole |
| SMILES | Cn1c(SCCCN2C[C@H]3N(c4ccccc4)CC[C@@]3(C)C2)nnc1C1CCOCC1 |
| InChI | InChI=1S/C24H35N5OS/c1-24-11-13-29(20-7-4-3-5-8-20)21(24)17-28(18-24)12-6-16-31-23-26-25-22(27(23)2)19-9-14-30-15-10-19/h3-5,7-8,19,21H,6,9-18H2,1-2H3/t21-,24+/m1/s1 |
| InChIKey | PWCZOAKLJUPDKK-QPPBQGQZSA-N |
| XLogP | 3.79 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.65 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|