C22H25F3N6OS — CID 126566361
4-methyl-5-[4-methyl-5-[3-[(1R,5S)-6-[4-(trifluoromethyl)phenyl]-3,6-diazabicyclo[3.2.0]heptan-3-yl]propylsulfanyl]-1,2,4-triazol-3-yl]-1,3-oxazole (PubChem CID 126566361) has the molecular formula C22H25F3N6OS and a molecular weight of 478.54 g/mol. Its IUPAC name is 4-methyl-5-[4-methyl-5-[3-[(1R,5S)-6-[4-(trifluoromethyl)phenyl]-3,6-diazabicyclo[3.2.0]heptan-3-yl]propylsulfanyl]-1,2,4-triazol-3-yl]-1,3-oxazole.
| Compound Name | 4-methyl-5-[4-methyl-5-[3-[(1R,5S)-6-[4-(trifluoromethyl)phenyl]-3,6-diazabicyclo[3.2.0]heptan-3-yl]propylsulfanyl]-1,2,4-triazol-3-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 126566361 |
| Molecular Formula | C22H25F3N6OS |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 4-methyl-5-[4-methyl-5-[3-[(1R,5S)-6-[4-(trifluoromethyl)phenyl]-3,6-diazabicyclo[3.2.0]heptan-3-yl]propylsulfanyl]-1,2,4-triazol-3-yl]-1,3-oxazole |
| SMILES | Cc1ncoc1-c1nnc(SCCCN2C[C@@H]3CN(c4ccc(C(F)(F)F)cc4)[C@@H]3C2)n1C |
| InChI | InChI=1S/C22H25F3N6OS/c1-14-19(32-13-26-14)20-27-28-21(29(20)2)33-9-3-8-30-10-15-11-31(18(15)12-30)17-6-4-16(5-7-17)22(23,24)25/h4-7,13,15,18H,3,8-12H2,1-2H3/t15-,18-/m1/s1 |
| InChIKey | VYCBASLVLXPETI-CRAIPNDOSA-N |
| XLogP | 4.10 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|