C19H18F2O5 — CID 126567792
[(2R,4S)-3,3-difluoro-5-hydroxy-4-phenylmethoxyoxolan-2-yl]methyl benzoate (PubChem CID 126567792) has the molecular formula C19H18F2O5 and a molecular weight of 364.34 g/mol. Its IUPAC name is [(2R,4S)-3,3-difluoro-5-hydroxy-4-phenylmethoxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,4S)-3,3-difluoro-5-hydroxy-4-phenylmethoxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 126567792 |
| Molecular Formula | C19H18F2O5 |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | [(2R,4S)-3,3-difluoro-5-hydroxy-4-phenylmethoxyoxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1OC(O)[C@H](OCc2ccccc2)C1(F)F)c1ccccc1 |
| InChI | InChI=1S/C19H18F2O5/c20-19(21)15(12-25-17(22)14-9-5-2-6-10-14)26-18(23)16(19)24-11-13-7-3-1-4-8-13/h1-10,15-16,18,23H,11-12H2/t15-,16+,18?/m1/s1 |
| InChIKey | PVOGFYMLKKFMQW-LNKXUWQBSA-N |
| XLogP | 2.78 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |