C25H33FN6O2 — CID 126569556
4-[2-(butylamino)-5-(3-fluoro-4-morpholin-4-ylphenyl)imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol (PubChem CID 126569556) has the molecular formula C25H33FN6O2 and a molecular weight of 468.58 g/mol. Its IUPAC name is 4-[2-(butylamino)-5-(3-fluoro-4-morpholin-4-ylphenyl)imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol.
| Compound Name | 4-[2-(butylamino)-5-(3-fluoro-4-morpholin-4-ylphenyl)imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 126569556 |
| Molecular Formula | C25H33FN6O2 |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 4-[2-(butylamino)-5-(3-fluoro-4-morpholin-4-ylphenyl)imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc2c(-c3ccc(N4CCOCC4)c(F)c3)nc(C3CCC(O)CC3)n2n1 |
| InChI | InChI=1S/C25H33FN6O2/c1-2-3-10-27-25-28-16-22-23(29-24(32(22)30-25)17-4-7-19(33)8-5-17)18-6-9-21(20(26)15-18)31-11-13-34-14-12-31/h6,9,15-17,19,33H,2-5,7-8,10-14H2,1H3,(H,27,30) |
| InChIKey | HHDZKPNYDOJMBN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 87.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|