C19H24N6O — CID 44589696
5-methyl-N-(3-morpholin-4-ylpropyl)-7-phenylimidazo[5,1-f][1,2,4]triazin-2-amine (PubChem CID 44589696) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is 5-methyl-N-(3-morpholin-4-ylpropyl)-7-phenylimidazo[5,1-f][1,2,4]triazin-2-amine.
| Compound Name | 5-methyl-N-(3-morpholin-4-ylpropyl)-7-phenylimidazo[5,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 44589696 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 5-methyl-N-(3-morpholin-4-ylpropyl)-7-phenylimidazo[5,1-f][1,2,4]triazin-2-amine |
| SMILES | Cc1nc(-c2ccccc2)n2nc(NCCCN3CCOCC3)ncc12 |
| InChI | InChI=1S/C19H24N6O/c1-15-17-14-21-19(20-8-5-9-24-10-12-26-13-11-24)23-25(17)18(22-15)16-6-3-2-4-7-16/h2-4,6-7,14H,5,8-13H2,1H3,(H,20,23) |
| InChIKey | IFOFHKDVJCOAMH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|