C21H21N5O — CID 129019494
2-[[6-(2-methyl-3-phenylphenyl)imidazo[1,2-b][1,2,4]triazin-2-yl]methylamino]ethanol (PubChem CID 129019494) has the molecular formula C21H21N5O and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-[[6-(2-methyl-3-phenylphenyl)imidazo[1,2-b][1,2,4]triazin-2-yl]methylamino]ethanol.
| Compound Name | 2-[[6-(2-methyl-3-phenylphenyl)imidazo[1,2-b][1,2,4]triazin-2-yl]methylamino]ethanol |
|---|---|
| PubChem CID | 129019494 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-[[6-(2-methyl-3-phenylphenyl)imidazo[1,2-b][1,2,4]triazin-2-yl]methylamino]ethanol |
| SMILES | Cc1c(-c2ccccc2)cccc1-c1cn2nc(CNCCO)cnc2n1 |
| InChI | InChI=1S/C21H21N5O/c1-15-18(16-6-3-2-4-7-16)8-5-9-19(15)20-14-26-21(24-20)23-13-17(25-26)12-22-10-11-27/h2-9,13-14,22,27H,10-12H2,1H3 |
| InChIKey | SIYAOZFRXTVXSP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|