C11H7N5O2 — CID 126571916
3-(3-nitrophenyl)imidazo[1,2-b][1,2,4]triazine (PubChem CID 126571916) has the molecular formula C11H7N5O2 and a molecular weight of 241.21 g/mol. Its IUPAC name is 3-(3-nitrophenyl)imidazo[1,2-b][1,2,4]triazine.
| Compound Name | 3-(3-nitrophenyl)imidazo[1,2-b][1,2,4]triazine |
|---|---|
| PubChem CID | 126571916 |
| Molecular Formula | C11H7N5O2 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 3-(3-nitrophenyl)imidazo[1,2-b][1,2,4]triazine |
| SMILES | O=[N+]([O-])c1cccc(-c2cnn3ccnc3n2)c1 |
| InChI | InChI=1S/C11H7N5O2/c17-16(18)9-3-1-2-8(6-9)10-7-13-15-5-4-12-11(15)14-10/h1-7H |
| InChIKey | QLINFLGPBVXFFG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|