About 3-(3-nitrophenyl)imidazo[1,2-b][1,2,4]triazine
3-(3-nitrophenyl)imidazo[1,2-b][1,2,4]triazine (PubChem CID 126571916) has the molecular formula C11H7N5O2
and a molecular weight of 241.21 g/mol. Its IUPAC name is 3-(3-nitrophenyl)imidazo[1,2-b][1,2,4]triazine.
Molecular Properties
| Compound Name | 3-(3-nitrophenyl)imidazo[1,2-b][1,2,4]triazine |
| PubChem CID | 126571916 |
| Molecular Formula | C11H7N5O2 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 3-(3-nitrophenyl)imidazo[1,2-b][1,2,4]triazine |
| SMILES | O=[N+]([O-])c1cccc(-c2cnn3ccnc3n2)c1 |
| InChI | InChI=1S/C11H7N5O2/c17-16(18)9-3-1-2-8(6-9)10-7-13-15-5-4-12-11(15)14-10/h1-7H |
| InChIKey | QLINFLGPBVXFFG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-nitrophenyl)imidazo[1,2-b][1,2,4]triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-nitrophenyl)imidazo[1,2-b][1,2,4]triazine?
The IUPAC name of 3-(3-nitrophenyl)imidazo[1,2-b][1,2,4]triazine (CID 126571916) is 3-(3-nitrophenyl)imidazo[1,2-b][1,2,4]triazine.
What is the SMILES notation for 3-(3-nitrophenyl)imidazo[1,2-b][1,2,4]triazine?
The canonical SMILES for 3-(3-nitrophenyl)imidazo[1,2-b][1,2,4]triazine is O=[N+]([O-])c1cccc(-c2cnn3ccnc3n2)c1.
What is the InChIKey of 3-(3-nitrophenyl)imidazo[1,2-b][1,2,4]triazine?
The InChIKey is QLINFLGPBVXFFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N5O2/c17-16(18)9-3-1-2-8(6-9)10-7-13-15-5-4-12-11(15)14-10/h1-7H.
What are the key properties of 3-(3-nitrophenyl)imidazo[1,2-b][1,2,4]triazine?
3-(3-nitrophenyl)imidazo[1,2-b][1,2,4]triazine has a molecular weight of 241.21 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-nitrophenyl)imidazo[1,2-b][1,2,4]triazine is sourced from PubChem (CID 126571916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).