C27H38N2O6 — CID 126573426
[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-[(6-methoxy-3-pyridinyl)methyl]azetidine-1-carboxylate (PubChem CID 126573426) has the molecular formula C27H38N2O6 and a molecular weight of 486.61 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-[(6-methoxy-3-pyridinyl)methyl]azetidine-1-carboxylate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-[(6-methoxy-3-pyridinyl)methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 126573426 |
| Molecular Formula | C27H38N2O6 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-[(6-methoxy-3-pyridinyl)methyl]azetidine-1-carboxylate |
| SMILES | COc1ccc(CC2CN(C(=O)O[C@@H]3CC[C@]4(CO4)[C@@H]([C@@]4(C)O[C@@H]4CC=C(C)C)[C@@H]3OC)C2)cn1 |
| InChI | InChI=1S/C27H38N2O6/c1-17(2)6-8-21-26(3,35-21)24-23(32-5)20(10-11-27(24)16-33-27)34-25(30)29-14-19(15-29)12-18-7-9-22(31-4)28-13-18/h6-7,9,13,19-21,23-24H,8,10-12,14-16H2,1-5H3/t20-,21-,23-,24-,26+,27+/m1/s1 |
| InChIKey | AEYOKLTZJOGJAD-OKOJUJPVSA-N |
| XLogP | 3.78 |
| TPSA | 85.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|