C11H17F3N2O3 — CID 126573504
4-[2-(azetidin-3-ylidene)ethyl]morpholine;2,2,2-trifluoroacetic acid (PubChem CID 126573504) has the molecular formula C11H17F3N2O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is 4-[2-(azetidin-3-ylidene)ethyl]morpholine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[2-(azetidin-3-ylidene)ethyl]morpholine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 126573504 |
| Molecular Formula | C11H17F3N2O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 4-[2-(azetidin-3-ylidene)ethyl]morpholine;2,2,2-trifluoroacetic acid |
| SMILES | C(CN1CCOCC1)=C1CNC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H16N2O.C2HF3O2/c1(9-7-10-8-9)2-11-3-5-12-6-4-11;3-2(4,5)1(6)7/h1,10H,2-8H2;(H,6,7) |
| InChIKey | MICOGBQVXRTELR-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|