C20H23NO4 — CID 126575109
4-methoxycarbonyl-3-[2-methyl-5-[(2R)-2-methylcyclopentyl]pyrrol-1-yl]benzoic acid (PubChem CID 126575109) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 4-methoxycarbonyl-3-[2-methyl-5-[(2R)-2-methylcyclopentyl]pyrrol-1-yl]benzoic acid.
| Compound Name | 4-methoxycarbonyl-3-[2-methyl-5-[(2R)-2-methylcyclopentyl]pyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 126575109 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 4-methoxycarbonyl-3-[2-methyl-5-[(2R)-2-methylcyclopentyl]pyrrol-1-yl]benzoic acid |
| SMILES | COC(=O)c1ccc(C(=O)O)cc1-n1c(C)ccc1C1CCC[C@H]1C |
| InChI | InChI=1S/C20H23NO4/c1-12-5-4-6-15(12)17-10-7-13(2)21(17)18-11-14(19(22)23)8-9-16(18)20(24)25-3/h7-12,15H,4-6H2,1-3H3,(H,22,23)/t12-,15?/m1/s1 |
| InChIKey | MZKOFIKJPVOUGQ-KEKZHRQWSA-N |
| XLogP | 4.17 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|