C17H19BrO3 — CID 126576809
[2-(4-bromophenyl)-2-oxoethyl] (3aR,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalene-2-carboxylate (PubChem CID 126576809) has the molecular formula C17H19BrO3 and a molecular weight of 351.24 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] (3aR,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalene-2-carboxylate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] (3aR,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalene-2-carboxylate |
|---|---|
| PubChem CID | 126576809 |
| Molecular Formula | C17H19BrO3 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] (3aR,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalene-2-carboxylate |
| SMILES | O=C(COC(=O)C1C[C@H]2CCC[C@H]2C1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H19BrO3/c18-15-6-4-11(5-7-15)16(19)10-21-17(20)14-8-12-2-1-3-13(12)9-14/h4-7,12-14H,1-3,8-10H2/t12-,13+,14? |
| InChIKey | KHKBMORUPACHJH-PBWFPOADSA-N |
| XLogP | 4.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |