C24H36Cl14O — CID 126578434
1,2,3,4,5,6,7,8,9,10,11,12,13,14-tetradecachloro-1-(4,4-dimethylpentoxy)-15-methylhexadecane (PubChem CID 126578434) has the molecular formula C24H36Cl14O and a molecular weight of 836.89 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8,9,10,11,12,13,14-tetradecachloro-1-(4,4-dimethylpentoxy)-15-methylhexadecane.
| Compound Name | 1,2,3,4,5,6,7,8,9,10,11,12,13,14-tetradecachloro-1-(4,4-dimethylpentoxy)-15-methylhexadecane |
|---|---|
| PubChem CID | 126578434 |
| Molecular Formula | C24H36Cl14O |
| Molecular Weight | 836.89 g/mol |
| Exact Mass | 829.84 |
| IUPAC Name | 1,2,3,4,5,6,7,8,9,10,11,12,13,14-tetradecachloro-1-(4,4-dimethylpentoxy)-15-methylhexadecane |
| SMILES | CC(C)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)OCCCC(C)(C)C |
| InChI | InChI=1S/C24H36Cl14O/c1-9(2)10(25)11(26)12(27)13(28)14(29)15(30)16(31)17(32)18(33)19(34)20(35)21(36)22(37)23(38)39-8-6-7-24(3,4)5/h9-23H,6-8H2,1-5H3 |
| InChIKey | XCLTUIQSZFCCQP-UHFFFAOYSA-N |
| XLogP | 11.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.89 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|