C11H14N8O3 — CID 126578582
4-azido-1-[(2R,3R,4S,5S)-3-azido-4-ethyl-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 126578582) has the molecular formula C11H14N8O3 and a molecular weight of 306.29 g/mol. Its IUPAC name is 4-azido-1-[(2R,3R,4S,5S)-3-azido-4-ethyl-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-azido-1-[(2R,3R,4S,5S)-3-azido-4-ethyl-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 126578582 |
| Molecular Formula | C11H14N8O3 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 4-azido-1-[(2R,3R,4S,5S)-3-azido-4-ethyl-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | CC[C@H]1[C@@H](N=[N+]=[N-])[C@H](n2ccc(N=[N+]=[N-])nc2=O)O[C@@H]1CO |
| InChI | InChI=1S/C11H14N8O3/c1-2-6-7(5-20)22-10(9(6)16-18-13)19-4-3-8(15-17-12)14-11(19)21/h3-4,6-7,9-10,20H,2,5H2,1H3/t6-,7-,9-,10-/m1/s1 |
| InChIKey | UMTOWJJDNBUYIR-KHUVANEUSA-N |
| XLogP | 1.78 |
| TPSA | 161.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|