C7H8N2 — CID 126580929
2-methyl-5-methylidene-1,3-diazepine (PubChem CID 126580929) has the molecular formula C7H8N2 and a molecular weight of 120.15 g/mol. Its IUPAC name is 2-methyl-5-methylidene-1,3-diazepine.
| Compound Name | 2-methyl-5-methylidene-1,3-diazepine |
|---|---|
| PubChem CID | 126580929 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 2-methyl-5-methylidene-1,3-diazepine |
| SMILES | C=C1C=CN=C(C)N=C1 |
| InChI | InChI=1S/C7H8N2/c1-6-3-4-8-7(2)9-5-6/h3-5H,1H2,2H3 |
| InChIKey | PVSVNHYJNVNHQJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |