C12H16N2 — CID 137496565
N'-[(1Z,3E)-4-methylhexa-1,3,5-trienyl]-N-prop-2-enylideneethanimidamide (PubChem CID 137496565) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is N'-[(1Z,3E)-4-methylhexa-1,3,5-trienyl]-N-prop-2-enylideneethanimidamide.
| Compound Name | N'-[(1Z,3E)-4-methylhexa-1,3,5-trienyl]-N-prop-2-enylideneethanimidamide |
|---|---|
| PubChem CID | 137496565 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | N'-[(1Z,3E)-4-methylhexa-1,3,5-trienyl]-N-prop-2-enylideneethanimidamide |
| SMILES | C=C/C=N/C(C)=N/C=C\C=C(/C)C=C |
| InChI | InChI=1S/C12H16N2/c1-5-9-13-12(4)14-10-7-8-11(3)6-2/h5-10H,1-2H2,3-4H3/b10-7-,11-8+,13-9+,14-12+ |
| InChIKey | XEXFYPYEWCKTBC-GDMWDUSKSA-N |
| XLogP | 3.31 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|