C22H23N3 — CID 126581357
5-buta-1,3-dien-2-yl-1-[2,6-dimethyl-4-(4-methylphenyl)phenyl]-3-methyl-1,2,4-triazole (PubChem CID 126581357) has the molecular formula C22H23N3 and a molecular weight of 329.45 g/mol. Its IUPAC name is 5-buta-1,3-dien-2-yl-1-[2,6-dimethyl-4-(4-methylphenyl)phenyl]-3-methyl-1,2,4-triazole.
| Compound Name | 5-buta-1,3-dien-2-yl-1-[2,6-dimethyl-4-(4-methylphenyl)phenyl]-3-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 126581357 |
| Molecular Formula | C22H23N3 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 5-buta-1,3-dien-2-yl-1-[2,6-dimethyl-4-(4-methylphenyl)phenyl]-3-methyl-1,2,4-triazole |
| SMILES | C=CC(=C)c1nc(C)nn1-c1c(C)cc(-c2ccc(C)cc2)cc1C |
| InChI | InChI=1S/C22H23N3/c1-7-15(3)22-23-18(6)24-25(22)21-16(4)12-20(13-17(21)5)19-10-8-14(2)9-11-19/h7-13H,1,3H2,2,4-6H3 |
| InChIKey | IIZDPJWSMDKZCV-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|