C57H56IrN3- — CID 164927747
5-[3-[3,5-bis[4-(3-phenylpentan-3-yl)phenyl]phenyl]benzene-6-id-1-yl]-1-(2,6-dimethylphenyl)-3-methyl-1,2,4-triazole;iridium (PubChem CID 164927747) has the molecular formula C57H56IrN3- and a molecular weight of 975.31 g/mol. Its IUPAC name is 5-[3-[3,5-bis[4-(3-phenylpentan-3-yl)phenyl]phenyl]benzene-6-id-1-yl]-1-(2,6-dimethylphenyl)-3-methyl-1,2,4-triazole;iridium.
| Compound Name | 5-[3-[3,5-bis[4-(3-phenylpentan-3-yl)phenyl]phenyl]benzene-6-id-1-yl]-1-(2,6-dimethylphenyl)-3-methyl-1,2,4-triazole;iridium |
|---|---|
| PubChem CID | 164927747 |
| Molecular Formula | C57H56IrN3- |
| Molecular Weight | 975.31 g/mol |
| Exact Mass | 975.41 |
| IUPAC Name | 5-[3-[3,5-bis[4-(3-phenylpentan-3-yl)phenyl]phenyl]benzene-6-id-1-yl]-1-(2,6-dimethylphenyl)-3-methyl-1,2,4-triazole;iridium |
| SMILES | CCC(CC)(c1ccccc1)c1ccc(-c2cc(-c3ccc(C(CC)(CC)c4ccccc4)cc3)cc(-c3cc[c-]c(-c4nc(C)nn4-c4c(C)cccc4C)c3)c2)cc1.[Ir] |
| InChI | InChI=1S/C57H56N3.Ir/c1-8-56(9-2,50-24-14-12-15-25-50)52-32-28-43(29-33-52)47-37-48(44-30-34-53(35-31-44)57(10-3,11-4)51-26-16-13-17-27-51)39-49(38-47)45-22-19-23-46(36-45)55-58-42(7)59-60(55)54-40(5)20-18-21-41(54)6;/h12-22,24-39H,8-11H2,1-7H3;/q-1; |
| InChIKey | AVQRQBNQHFGUSV-UHFFFAOYSA-N |
| XLogP | 14.87 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 975.31 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|