C17H24N4O2 — CID 126582851
5-[4-hydrazinyl-3-(1-methoxypropan-2-ylamino)phenyl]-1,3-dimethylpyridin-2-one (PubChem CID 126582851) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 5-[4-hydrazinyl-3-(1-methoxypropan-2-ylamino)phenyl]-1,3-dimethylpyridin-2-one.
| Compound Name | 5-[4-hydrazinyl-3-(1-methoxypropan-2-ylamino)phenyl]-1,3-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 126582851 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 5-[4-hydrazinyl-3-(1-methoxypropan-2-ylamino)phenyl]-1,3-dimethylpyridin-2-one |
| SMILES | COCC(C)Nc1cc(-c2cc(C)c(=O)n(C)c2)ccc1NN |
| InChI | InChI=1S/C17H24N4O2/c1-11-7-14(9-21(3)17(11)22)13-5-6-15(20-18)16(8-13)19-12(2)10-23-4/h5-9,12,19-20H,10,18H2,1-4H3 |
| InChIKey | OTZVYIAHDBPVGI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|