C17H20F3N3O2 — CID 126572486
5-[4-amino-3-[2-(2,2,2-trifluoroethoxy)ethylamino]phenyl]-1,3-dimethylpyridin-2-one (PubChem CID 126572486) has the molecular formula C17H20F3N3O2 and a molecular weight of 355.36 g/mol. Its IUPAC name is 5-[4-amino-3-[2-(2,2,2-trifluoroethoxy)ethylamino]phenyl]-1,3-dimethylpyridin-2-one.
| Compound Name | 5-[4-amino-3-[2-(2,2,2-trifluoroethoxy)ethylamino]phenyl]-1,3-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 126572486 |
| Molecular Formula | C17H20F3N3O2 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 5-[4-amino-3-[2-(2,2,2-trifluoroethoxy)ethylamino]phenyl]-1,3-dimethylpyridin-2-one |
| SMILES | Cc1cc(-c2ccc(N)c(NCCOCC(F)(F)F)c2)cn(C)c1=O |
| InChI | InChI=1S/C17H20F3N3O2/c1-11-7-13(9-23(2)16(11)24)12-3-4-14(21)15(8-12)22-5-6-25-10-17(18,19)20/h3-4,7-9,22H,5-6,10,21H2,1-2H3 |
| InChIKey | WXAKFDPGXRUIKH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|