C15H16ClNO — CID 134247830
5-[4-(chloromethyl)-3-methylphenyl]-1,3-dimethylpyridin-2-one (PubChem CID 134247830) has the molecular formula C15H16ClNO and a molecular weight of 261.75 g/mol. Its IUPAC name is 5-[4-(chloromethyl)-3-methylphenyl]-1,3-dimethylpyridin-2-one.
| Compound Name | 5-[4-(chloromethyl)-3-methylphenyl]-1,3-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 134247830 |
| Molecular Formula | C15H16ClNO |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 5-[4-(chloromethyl)-3-methylphenyl]-1,3-dimethylpyridin-2-one |
| SMILES | Cc1cc(-c2cc(C)c(=O)n(C)c2)ccc1CCl |
| InChI | InChI=1S/C15H16ClNO/c1-10-6-12(4-5-13(10)8-16)14-7-11(2)15(18)17(3)9-14/h4-7,9H,8H2,1-3H3 |
| InChIKey | OMLFUKYSCHAPTR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|