C15H12N2O3 — CID 126572990
7-(1,5-dimethyl-6-oxo-3-pyridinyl)-1,4-benzoxazin-2-one (PubChem CID 126572990) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 7-(1,5-dimethyl-6-oxo-3-pyridinyl)-1,4-benzoxazin-2-one.
| Compound Name | 7-(1,5-dimethyl-6-oxo-3-pyridinyl)-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 126572990 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 7-(1,5-dimethyl-6-oxo-3-pyridinyl)-1,4-benzoxazin-2-one |
| SMILES | Cc1cc(-c2ccc3ncc(=O)oc3c2)cn(C)c1=O |
| InChI | InChI=1S/C15H12N2O3/c1-9-5-11(8-17(2)15(9)19)10-3-4-12-13(6-10)20-14(18)7-16-12/h3-8H,1-2H3 |
| InChIKey | NLHHYPGPSFFMTC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |