C15H18N2O — CID 134258642
5-[4-[(1R)-1-aminoethyl]phenyl]-1,3-dimethylpyridin-2-one (PubChem CID 134258642) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is 5-[4-[(1R)-1-aminoethyl]phenyl]-1,3-dimethylpyridin-2-one.
| Compound Name | 5-[4-[(1R)-1-aminoethyl]phenyl]-1,3-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 134258642 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 5-[4-[(1R)-1-aminoethyl]phenyl]-1,3-dimethylpyridin-2-one |
| SMILES | Cc1cc(-c2ccc([C@@H](C)N)cc2)cn(C)c1=O |
| InChI | InChI=1S/C15H18N2O/c1-10-8-14(9-17(3)15(10)18)13-6-4-12(5-7-13)11(2)16/h4-9,11H,16H2,1-3H3/t11-/m1/s1 |
| InChIKey | KQAQSBFWDKNOBT-LLVKDONJSA-N |
| XLogP | 2.38 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |