C13H15N3O — CID 126582767
5-(3,4-diaminophenyl)-1,3-dimethylpyridin-2-one (PubChem CID 126582767) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 5-(3,4-diaminophenyl)-1,3-dimethylpyridin-2-one.
| Compound Name | 5-(3,4-diaminophenyl)-1,3-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 126582767 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 5-(3,4-diaminophenyl)-1,3-dimethylpyridin-2-one |
| SMILES | Cc1cc(-c2ccc(N)c(N)c2)cn(C)c1=O |
| InChI | InChI=1S/C13H15N3O/c1-8-5-10(7-16(2)13(8)17)9-3-4-11(14)12(15)6-9/h3-7H,14-15H2,1-2H3 |
| InChIKey | AMZINFJXHMSAHZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 74.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|