C20H26ClNO2 — CID 145148149
chlorocyclobutane;5-(4-ethyl-3-methoxyphenyl)-1,3-dimethylpyridin-2-one (PubChem CID 145148149) has the molecular formula C20H26ClNO2 and a molecular weight of 347.89 g/mol. Its IUPAC name is chlorocyclobutane;5-(4-ethyl-3-methoxyphenyl)-1,3-dimethylpyridin-2-one.
| Compound Name | chlorocyclobutane;5-(4-ethyl-3-methoxyphenyl)-1,3-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 145148149 |
| Molecular Formula | C20H26ClNO2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | chlorocyclobutane;5-(4-ethyl-3-methoxyphenyl)-1,3-dimethylpyridin-2-one |
| SMILES | CCc1ccc(-c2cc(C)c(=O)n(C)c2)cc1OC.ClC1CCC1 |
| InChI | InChI=1S/C16H19NO2.C4H7Cl/c1-5-12-6-7-13(9-15(12)19-4)14-8-11(2)16(18)17(3)10-14;5-4-2-1-3-4/h6-10H,5H2,1-4H3;4H,1-3H2 |
| InChIKey | JTZDCGGITPWFTM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|