C16H18BrNO — CID 134247860
5-[4-(bromomethyl)-2,5-dimethylphenyl]-1,3-dimethylpyridin-2-one (PubChem CID 134247860) has the molecular formula C16H18BrNO and a molecular weight of 320.23 g/mol. Its IUPAC name is 5-[4-(bromomethyl)-2,5-dimethylphenyl]-1,3-dimethylpyridin-2-one.
| Compound Name | 5-[4-(bromomethyl)-2,5-dimethylphenyl]-1,3-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 134247860 |
| Molecular Formula | C16H18BrNO |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 5-[4-(bromomethyl)-2,5-dimethylphenyl]-1,3-dimethylpyridin-2-one |
| SMILES | Cc1cc(-c2cc(C)c(=O)n(C)c2)c(C)cc1CBr |
| InChI | InChI=1S/C16H18BrNO/c1-10-7-15(11(2)5-13(10)8-17)14-6-12(3)16(19)18(4)9-14/h5-7,9H,8H2,1-4H3 |
| InChIKey | DERSAFZNKSVWQW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|