C15H20N2 — CID 126583344
1,3-dimethyl-4-piperidin-1-ylindole (PubChem CID 126583344) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 1,3-dimethyl-4-piperidin-1-ylindole.
| Compound Name | 1,3-dimethyl-4-piperidin-1-ylindole |
|---|---|
| PubChem CID | 126583344 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 1,3-dimethyl-4-piperidin-1-ylindole |
| SMILES | Cc1cn(C)c2cccc(N3CCCCC3)c12 |
| InChI | InChI=1S/C15H20N2/c1-12-11-16(2)13-7-6-8-14(15(12)13)17-9-4-3-5-10-17/h6-8,11H,3-5,9-10H2,1-2H3 |
| InChIKey | PWBACRCQESEVMX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |