C13H17NO2 — CID 79694992
2-methyl-6-piperidin-1-ylbenzoic acid (PubChem CID 79694992) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-methyl-6-piperidin-1-ylbenzoic acid.
| Compound Name | 2-methyl-6-piperidin-1-ylbenzoic acid |
|---|---|
| PubChem CID | 79694992 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-methyl-6-piperidin-1-ylbenzoic acid |
| SMILES | Cc1cccc(N2CCCCC2)c1C(=O)O |
| InChI | InChI=1S/C13H17NO2/c1-10-6-5-7-11(12(10)13(15)16)14-8-3-2-4-9-14/h5-7H,2-4,8-9H2,1H3,(H,15,16) |
| InChIKey | YXGKMFRCZPMTJE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |