C16H15NO4 — CID 104962826
2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-6-methylbenzoic acid (PubChem CID 104962826) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-6-methylbenzoic acid.
| Compound Name | 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-6-methylbenzoic acid |
|---|---|
| PubChem CID | 104962826 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-6-methylbenzoic acid |
| SMILES | Cc1cccc(N2C(=O)[C@H]3CC=CC[C@H]3C2=O)c1C(=O)O |
| InChI | InChI=1S/C16H15NO4/c1-9-5-4-8-12(13(9)16(20)21)17-14(18)10-6-2-3-7-11(10)15(17)19/h2-5,8,10-11H,6-7H2,1H3,(H,20,21)/t10-,11+ |
| InChIKey | GDHHTQGEEIDJPE-PHIMTYICSA-N |
| XLogP | 2.15 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|