C12H16N2 — CID 117204432
1-(1,3-dimethylindol-4-yl)-N-methylmethanamine (PubChem CID 117204432) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-(1,3-dimethylindol-4-yl)-N-methylmethanamine.
| Compound Name | 1-(1,3-dimethylindol-4-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 117204432 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1-(1,3-dimethylindol-4-yl)-N-methylmethanamine |
| SMILES | CNCc1cccc2c1c(C)cn2C |
| InChI | InChI=1S/C12H16N2/c1-9-8-14(3)11-6-4-5-10(7-13-2)12(9)11/h4-6,8,13H,7H2,1-3H3 |
| InChIKey | HCNJBLBGYHVEKN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |