C13H18N2 — CID 117204456
2-(1,3-dimethylindol-4-yl)-N-methylethanamine (PubChem CID 117204456) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-(1,3-dimethylindol-4-yl)-N-methylethanamine.
| Compound Name | 2-(1,3-dimethylindol-4-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 117204456 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 2-(1,3-dimethylindol-4-yl)-N-methylethanamine |
| SMILES | CNCCc1cccc2c1c(C)cn2C |
| InChI | InChI=1S/C13H18N2/c1-10-9-15(3)12-6-4-5-11(13(10)12)7-8-14-2/h4-6,9,14H,7-8H2,1-3H3 |
| InChIKey | NWPWFTXIBCOKJF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|