C14H19NO — CID 117204407
1-(1,3-dimethylindol-4-yl)-2-methylpropan-2-ol (PubChem CID 117204407) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 1-(1,3-dimethylindol-4-yl)-2-methylpropan-2-ol.
| Compound Name | 1-(1,3-dimethylindol-4-yl)-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 117204407 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 1-(1,3-dimethylindol-4-yl)-2-methylpropan-2-ol |
| SMILES | Cc1cn(C)c2cccc(CC(C)(C)O)c12 |
| InChI | InChI=1S/C14H19NO/c1-10-9-15(4)12-7-5-6-11(13(10)12)8-14(2,3)16/h5-7,9,16H,8H2,1-4H3 |
| InChIKey | GTTJPYAOMSBDQH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |