C23H30BrN3O3 — CID 126583426
(2R)-N-[(8-bromo-4-pentoxyquinolin-2-yl)methyl]-N-cyclopropylmorpholine-2-carboxamide (PubChem CID 126583426) has the molecular formula C23H30BrN3O3 and a molecular weight of 476.42 g/mol. Its IUPAC name is (2R)-N-[(8-bromo-4-pentoxyquinolin-2-yl)methyl]-N-cyclopropylmorpholine-2-carboxamide.
| Compound Name | (2R)-N-[(8-bromo-4-pentoxyquinolin-2-yl)methyl]-N-cyclopropylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 126583426 |
| Molecular Formula | C23H30BrN3O3 |
| Molecular Weight | 476.42 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | (2R)-N-[(8-bromo-4-pentoxyquinolin-2-yl)methyl]-N-cyclopropylmorpholine-2-carboxamide |
| SMILES | CCCCCOc1cc(CN(C(=O)[C@H]2CNCCO2)C2CC2)nc2c(Br)cccc12 |
| InChI | InChI=1S/C23H30BrN3O3/c1-2-3-4-11-29-20-13-16(26-22-18(20)6-5-7-19(22)24)15-27(17-8-9-17)23(28)21-14-25-10-12-30-21/h5-7,13,17,21,25H,2-4,8-12,14-15H2,1H3/t21-/m1/s1 |
| InChIKey | OKYMRLJJTXRDPG-OAQYLSRUSA-N |
| XLogP | 4.05 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|