C24H37N3O3 — CID 126583504
tert-butyl N-[[4-(cyclopentanecarboximidoyl)-3-(3-hydroxypropylamino)phenyl]methyl]-N-cyclopropylcarbamate (PubChem CID 126583504) has the molecular formula C24H37N3O3 and a molecular weight of 415.58 g/mol. Its IUPAC name is tert-butyl N-[[4-(cyclopentanecarboximidoyl)-3-(3-hydroxypropylamino)phenyl]methyl]-N-cyclopropylcarbamate.
| Compound Name | tert-butyl N-[[4-(cyclopentanecarboximidoyl)-3-(3-hydroxypropylamino)phenyl]methyl]-N-cyclopropylcarbamate |
|---|---|
| PubChem CID | 126583504 |
| Molecular Formula | C24H37N3O3 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | tert-butyl N-[[4-(cyclopentanecarboximidoyl)-3-(3-hydroxypropylamino)phenyl]methyl]-N-cyclopropylcarbamate |
| SMILES | [H]/N=C(/c1ccc(CN(C(=O)OC(C)(C)C)C2CC2)cc1NCCCO)C1CCCC1 |
| InChI | InChI=1S/C24H37N3O3/c1-24(2,3)30-23(29)27(19-10-11-19)16-17-9-12-20(21(15-17)26-13-6-14-28)22(25)18-7-4-5-8-18/h9,12,15,18-19,25-26,28H,4-8,10-11,13-14,16H2,1-3H3/b25-22+ |
| InChIKey | LCCNLGCWLBRMFP-YYDJUVGSSA-N |
| XLogP | 4.94 |
| TPSA | 85.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|