C7H12O3 — CID 126584563
(1R,3S,4S,6S,7S)-1-(deuteriomethyl)-6-methyl-3-tritio-2,5-dioxabicyclo[2.2.1]heptan-7-ol (PubChem CID 126584563) has the molecular formula C7H12O3 and a molecular weight of 147.18 g/mol. Its IUPAC name is (1R,3S,4S,6S,7S)-1-(deuteriomethyl)-6-methyl-3-tritio-2,5-dioxabicyclo[2.2.1]heptan-7-ol.
| Compound Name | (1R,3S,4S,6S,7S)-1-(deuteriomethyl)-6-methyl-3-tritio-2,5-dioxabicyclo[2.2.1]heptan-7-ol |
|---|---|
| PubChem CID | 126584563 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | (1R,3S,4S,6S,7S)-1-(deuteriomethyl)-6-methyl-3-tritio-2,5-dioxabicyclo[2.2.1]heptan-7-ol |
| SMILES | [2H]C[C@]12O[C@@H]([3H])[C@H](O[C@H]1C)[C@@H]2O |
| InChI | InChI=1S/C7H12O3/c1-4-7(2)6(8)5(10-4)3-9-7/h4-6,8H,3H2,1-2H3/t4-,5-,6-,7-/m0/s1/i2D,3T/t3-,4-,5-,6-,7- |
| InChIKey | KMQPGNZPZIBRKN-JBAUCUEUSA-N |
| XLogP | -0.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |