C11H14N2O5 — CID 58338739
1-[(1S,3R,4S,7R)-1-(deuteriomethyl)-7-hydroxy-6-methyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione (PubChem CID 58338739) has the molecular formula C11H14N2O5 and a molecular weight of 255.25 g/mol. Its IUPAC name is 1-[(1S,3R,4S,7R)-1-(deuteriomethyl)-7-hydroxy-6-methyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1S,3R,4S,7R)-1-(deuteriomethyl)-7-hydroxy-6-methyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58338739 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 1-[(1S,3R,4S,7R)-1-(deuteriomethyl)-7-hydroxy-6-methyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione |
| SMILES | [2H]C[C@@]12O[C@@H](n3ccc(=O)[nH]c3=O)[C@@H](OC1C)[C@H]2O |
| InChI | InChI=1S/C11H14N2O5/c1-5-11(2)8(15)7(17-5)9(18-11)13-4-3-6(14)12-10(13)16/h3-5,7-9,15H,1-2H3,(H,12,14,16)/t5?,7-,8+,9+,11+/m0/s1/i2D |
| InChIKey | FAFWIULZUKHPPJ-KGACKICWSA-N |
| XLogP | -1.03 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |