C23H22N2O2 — CID 126587514
6-benzyl-7-(1,5-dimethyl-6-oxo-3-pyridinyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 126587514) has the molecular formula C23H22N2O2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 6-benzyl-7-(1,5-dimethyl-6-oxo-3-pyridinyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-benzyl-7-(1,5-dimethyl-6-oxo-3-pyridinyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 126587514 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 6-benzyl-7-(1,5-dimethyl-6-oxo-3-pyridinyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Cc1cc(-c2cc3c(cc2Cc2ccccc2)CCC(=O)N3)cn(C)c1=O |
| InChI | InChI=1S/C23H22N2O2/c1-15-10-19(14-25(2)23(15)27)20-13-21-17(8-9-22(26)24-21)12-18(20)11-16-6-4-3-5-7-16/h3-7,10,12-14H,8-9,11H2,1-2H3,(H,24,26) |
| InChIKey | RRXONMHKAACGRU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |