C23H25N3O2 — CID 145256295
7-(1,5-dimethyl-6-oxo-3-pyridinyl)-6-[(2Z)-2-(methyliminomethyl)penta-2,4-dienyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 145256295) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 7-(1,5-dimethyl-6-oxo-3-pyridinyl)-6-[(2Z)-2-(methyliminomethyl)penta-2,4-dienyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-(1,5-dimethyl-6-oxo-3-pyridinyl)-6-[(2Z)-2-(methyliminomethyl)penta-2,4-dienyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 145256295 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 7-(1,5-dimethyl-6-oxo-3-pyridinyl)-6-[(2Z)-2-(methyliminomethyl)penta-2,4-dienyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | C=C/C=C(\C=N\C)Cc1cc2c(cc1-c1cc(C)c(=O)n(C)c1)NC(=O)CC2 |
| InChI | InChI=1S/C23H25N3O2/c1-5-6-16(13-24-3)10-18-11-17-7-8-22(27)25-21(17)12-20(18)19-9-15(2)23(28)26(4)14-19/h5-6,9,11-14H,1,7-8,10H2,2-4H3,(H,25,27)/b16-6-,24-13+ |
| InChIKey | PJQQVCBVRRFDLX-JWGBBTRKSA-N |
| XLogP | 3.60 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|