C17H24N4O2 — CID 174012016
6-[2-[[3-amino-2-(methyliminomethyl)prop-2-enyl]-methylamino]ethoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 174012016) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 6-[2-[[3-amino-2-(methyliminomethyl)prop-2-enyl]-methylamino]ethoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[2-[[3-amino-2-(methyliminomethyl)prop-2-enyl]-methylamino]ethoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 174012016 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 6-[2-[[3-amino-2-(methyliminomethyl)prop-2-enyl]-methylamino]ethoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | C/N=C/C(=CN)CN(C)CCOc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C17H24N4O2/c1-19-11-13(10-18)12-21(2)7-8-23-15-4-5-16-14(9-15)3-6-17(22)20-16/h4-5,9-11H,3,6-8,12,18H2,1-2H3,(H,20,22)/b13-10?,19-11+ |
| InChIKey | VAVOMCKOBDQKIL-ADZAVRFOSA-N |
| XLogP | 1.43 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|