About 3-[5-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-(methylamino)-3-(oxan-4-ylmethoxy)phenyl]propanal
3-[5-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-(methylamino)-3-(oxan-4-ylmethoxy)phenyl]propanal (PubChem CID 126587682) has the molecular formula C23H30N2O4
and a molecular weight of 398.50 g/mol. Its IUPAC name is 3-[5-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-(methylamino)-3-(oxan-4-ylmethoxy)phenyl]propanal.
Molecular Properties
| Compound Name | 3-[5-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-(methylamino)-3-(oxan-4-ylmethoxy)phenyl]propanal |
| PubChem CID | 126587682 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 3-[5-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-(methylamino)-3-(oxan-4-ylmethoxy)phenyl]propanal |
| SMILES | CNc1c(CCC=O)cc(-c2cc(C)c(=O)n(C)c2)cc1OCC1CCOCC1 |
| InChI | InChI=1S/C23H30N2O4/c1-16-11-20(14-25(3)23(16)27)19-12-18(5-4-8-26)22(24-2)21(13-19)29-15-17-6-9-28-10-7-17/h8,11-14,17,24H,4-7,9-10,15H2,1-3H3 |
| InChIKey | UFLRDGNUHZFZGZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-(methylamino)-3-(oxan-4-ylmethoxy)phenyl]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-(methylamino)-3-(oxan-4-ylmethoxy)phenyl]propanal?
The IUPAC name of 3-[5-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-(methylamino)-3-(oxan-4-ylmethoxy)phenyl]propanal (CID 126587682) is 3-[5-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-(methylamino)-3-(oxan-4-ylmethoxy)phenyl]propanal.
What is the SMILES notation for 3-[5-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-(methylamino)-3-(oxan-4-ylmethoxy)phenyl]propanal?
The canonical SMILES for 3-[5-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-(methylamino)-3-(oxan-4-ylmethoxy)phenyl]propanal is CNc1c(CCC=O)cc(-c2cc(C)c(=O)n(C)c2)cc1OCC1CCOCC1.
What is the InChIKey of 3-[5-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-(methylamino)-3-(oxan-4-ylmethoxy)phenyl]propanal?
The InChIKey is UFLRDGNUHZFZGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N2O4/c1-16-11-20(14-25(3)23(16)27)19-12-18(5-4-8-26)22(24-2)21(13-19)29-15-17-6-9-28-10-7-17/h8,11-14,17,24H,4-7,9-10,15H2,1-3H3.
What are the key properties of 3-[5-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-(methylamino)-3-(oxan-4-ylmethoxy)phenyl]propanal?
3-[5-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-(methylamino)-3-(oxan-4-ylmethoxy)phenyl]propanal has a molecular weight of 398.50 g/mol, XLogP of 3.34, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-(methylamino)-3-(oxan-4-ylmethoxy)phenyl]propanal is sourced from PubChem (CID 126587682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).