C20H30IN7O10 — CID 126589473
4-[[2-[[2-[[(1S)-2-[(2-amino-2-hydroxyethyl)amino]-1-iodo-2-oxoethyl]amino]-2-hydroxyethyl]amino]-2-oxoethyl]amino]-3-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-4-oxobutanoic acid (PubChem CID 126589473) has the molecular formula C20H30IN7O10 and a molecular weight of 655.40 g/mol. Its IUPAC name is 4-[[2-[[2-[[(1S)-2-[(2-amino-2-hydroxyethyl)amino]-1-iodo-2-oxoethyl]amino]-2-hydroxyethyl]amino]-2-oxoethyl]amino]-3-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[2-[[2-[[(1S)-2-[(2-amino-2-hydroxyethyl)amino]-1-iodo-2-oxoethyl]amino]-2-hydroxyethyl]amino]-2-oxoethyl]amino]-3-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 126589473 |
| Molecular Formula | C20H30IN7O10 |
| Molecular Weight | 655.40 g/mol |
| Exact Mass | 655.11 |
| IUPAC Name | 4-[[2-[[2-[[(1S)-2-[(2-amino-2-hydroxyethyl)amino]-1-iodo-2-oxoethyl]amino]-2-hydroxyethyl]amino]-2-oxoethyl]amino]-3-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-4-oxobutanoic acid |
| SMILES | NC(O)CNC(=O)[C@H](I)NC(O)CNC(=O)CNC(=O)C(CC(=O)O)NC(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C20H30IN7O10/c21-18(20(38)24-7-11(22)29)27-14(32)9-23-13(31)8-25-19(37)10(6-17(35)36)26-12(30)2-1-5-28-15(33)3-4-16(28)34/h3-4,10-11,14,18,27,29,32H,1-2,5-9,22H2,(H,23,31)(H,24,38)(H,25,37)(H,26,30)(H,35,36)/t10?,11?,14?,18-/m1/s1 |
| InChIKey | VXFXCZKEQLTXIE-BRIBDAFQSA-N |
| XLogP | -5.05 |
| TPSA | 269.59 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.40 |
| LogP ≤ 5 | -5.05 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|