C21H21F3N4O3 — CID 126591378
N-[3-[(3S,4aR,7aS)-2-amino-3,4a-difluoro-3-methyl-5,7-dihydro-4H-furo[3,4-b]pyridin-7a-yl]-4-fluorophenyl]-5-methoxypyridine-2-carboxamide (PubChem CID 126591378) has the molecular formula C21H21F3N4O3 and a molecular weight of 434.42 g/mol. Its IUPAC name is N-[3-[(3S,4aR,7aS)-2-amino-3,4a-difluoro-3-methyl-5,7-dihydro-4H-furo[3,4-b]pyridin-7a-yl]-4-fluorophenyl]-5-methoxypyridine-2-carboxamide.
| Compound Name | N-[3-[(3S,4aR,7aS)-2-amino-3,4a-difluoro-3-methyl-5,7-dihydro-4H-furo[3,4-b]pyridin-7a-yl]-4-fluorophenyl]-5-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 126591378 |
| Molecular Formula | C21H21F3N4O3 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N-[3-[(3S,4aR,7aS)-2-amino-3,4a-difluoro-3-methyl-5,7-dihydro-4H-furo[3,4-b]pyridin-7a-yl]-4-fluorophenyl]-5-methoxypyridine-2-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(F)c([C@]34COC[C@@]3(F)C[C@](C)(F)C(N)=N4)c2)nc1 |
| InChI | InChI=1S/C21H21F3N4O3/c1-19(23)9-20(24)10-31-11-21(20,28-18(19)25)14-7-12(3-5-15(14)22)27-17(29)16-6-4-13(30-2)8-26-16/h3-8H,9-11H2,1-2H3,(H2,25,28)(H,27,29)/t19-,20-,21+/m0/s1 |
| InChIKey | KAFPMBZSTVDIGX-PCCBWWKXSA-N |
| XLogP | 2.90 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |