C33H35ClFN3O5 — CID 126591904
2-(8-chloro-17-fluoro-4,5,28-trimethyl-21,24,27-trioxa-1,7,34-triazahexacyclo[26.2.2.16,9.110,14.02,7.015,20]tetratriaconta-2,4,6(34),8,10,12,14(33),15(20),16,18-decaen-3-yl)acetic acid (PubChem CID 126591904) has the molecular formula C33H35ClFN3O5 and a molecular weight of 608.11 g/mol. Its IUPAC name is 2-(8-chloro-17-fluoro-4,5,28-trimethyl-21,24,27-trioxa-1,7,34-triazahexacyclo[26.2.2.16,9.110,14.02,7.015,20]tetratriaconta-2,4,6(34),8,10,12,14(33),15(20),16,18-decaen-3-yl)acetic acid.
| Compound Name | 2-(8-chloro-17-fluoro-4,5,28-trimethyl-21,24,27-trioxa-1,7,34-triazahexacyclo[26.2.2.16,9.110,14.02,7.015,20]tetratriaconta-2,4,6(34),8,10,12,14(33),15(20),16,18-decaen-3-yl)acetic acid |
|---|---|
| PubChem CID | 126591904 |
| Molecular Formula | C33H35ClFN3O5 |
| Molecular Weight | 608.11 g/mol |
| Exact Mass | 607.22 |
| IUPAC Name | 2-(8-chloro-17-fluoro-4,5,28-trimethyl-21,24,27-trioxa-1,7,34-triazahexacyclo[26.2.2.16,9.110,14.02,7.015,20]tetratriaconta-2,4,6(34),8,10,12,14(33),15(20),16,18-decaen-3-yl)acetic acid |
| SMILES | Cc1c(CC(=O)O)c2n3c(Cl)c(nc3c1C)-c1cccc(c1)-c1cc(F)ccc1OCCOCCOC1(C)CCN2CC1 |
| InChI | InChI=1S/C33H35ClFN3O5/c1-20-21(2)31-36-29-23-6-4-5-22(17-23)26-18-24(35)7-8-27(26)42-15-13-41-14-16-43-33(3)9-11-37(12-10-33)32(38(31)30(29)34)25(20)19-28(39)40/h4-8,17-18H,9-16,19H2,1-3H3,(H,39,40) |
| InChIKey | PDUSIKQYZDMSJZ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.11 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|