C10H16N2 — CID 126593765
N-[(3E,5E)-7-methylocta-3,5-dien-2-ylidene]methanimidamide (PubChem CID 126593765) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is N-[(3E,5E)-7-methylocta-3,5-dien-2-ylidene]methanimidamide.
| Compound Name | N-[(3E,5E)-7-methylocta-3,5-dien-2-ylidene]methanimidamide |
|---|---|
| PubChem CID | 126593765 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N-[(3E,5E)-7-methylocta-3,5-dien-2-ylidene]methanimidamide |
| SMILES | CC(C)/C=C/C=C/C(=NC=N)C |
| InChI | InChI=1S/C10H16N2/c1-9(2)6-4-5-7-10(3)12-8-11/h4-9,11H,1-3H3/b6-4+,7-5+,11-8?,12-10? |
| InChIKey | OVLABBDENUOMJI-IKVQBEAFSA-N |
| XLogP | 2.30 |
| TPSA | 36.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | 210 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|