About [4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinolin-2-yl]methanol
[4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinolin-2-yl]methanol (PubChem CID 126593944) has the molecular formula C23H19ClN2O
and a molecular weight of 374.87 g/mol. Its IUPAC name is [4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinolin-2-yl]methanol.
Molecular Properties
| Compound Name | [4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinolin-2-yl]methanol |
| PubChem CID | 126593944 |
| Molecular Formula | C23H19ClN2O |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | [4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinolin-2-yl]methanol |
| SMILES | Cc1cc2nc(CO)cc(-c3ccccc3Cl)c2c(C)c1-c1ccncc1 |
| InChI | InChI=1S/C23H19ClN2O/c1-14-11-21-23(15(2)22(14)16-7-9-25-10-8-16)19(12-17(13-27)26-21)18-5-3-4-6-20(18)24/h3-12,27H,13H2,1-2H3 |
| InChIKey | DKROGFMMZXQANQ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinolin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinolin-2-yl]methanol?
The IUPAC name of [4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinolin-2-yl]methanol (CID 126593944) is [4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinolin-2-yl]methanol.
What is the SMILES notation for [4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinolin-2-yl]methanol?
The canonical SMILES for [4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinolin-2-yl]methanol is Cc1cc2nc(CO)cc(-c3ccccc3Cl)c2c(C)c1-c1ccncc1.
What is the InChIKey of [4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinolin-2-yl]methanol?
The InChIKey is DKROGFMMZXQANQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19ClN2O/c1-14-11-21-23(15(2)22(14)16-7-9-25-10-8-16)19(12-17(13-27)26-21)18-5-3-4-6-20(18)24/h3-12,27H,13H2,1-2H3.
What are the key properties of [4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinolin-2-yl]methanol?
[4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinolin-2-yl]methanol has a molecular weight of 374.87 g/mol, XLogP of 5.73, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinolin-2-yl]methanol is sourced from PubChem (CID 126593944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).