C9H7F2N — CID 126599832
4,5-difluoro-1-methylindole (PubChem CID 126599832) has the molecular formula C9H7F2N and a molecular weight of 167.16 g/mol. Its IUPAC name is 4,5-difluoro-1-methylindole.
| Compound Name | 4,5-difluoro-1-methylindole |
|---|---|
| PubChem CID | 126599832 |
| Molecular Formula | C9H7F2N |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 4,5-difluoro-1-methylindole |
| SMILES | Cn1ccc2c(F)c(F)ccc21 |
| InChI | InChI=1S/C9H7F2N/c1-12-5-4-6-8(12)3-2-7(10)9(6)11/h2-5H,1H3 |
| InChIKey | GXLCWLVBTDJLNU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |