C26H22N4O2 — CID 126601505
2-[3-(2-cyclopropylethynyl)-7-pyridin-4-ylindazol-2-yl]-N-hydroxy-3-phenylpropanamide (PubChem CID 126601505) has the molecular formula C26H22N4O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-[3-(2-cyclopropylethynyl)-7-pyridin-4-ylindazol-2-yl]-N-hydroxy-3-phenylpropanamide.
| Compound Name | 2-[3-(2-cyclopropylethynyl)-7-pyridin-4-ylindazol-2-yl]-N-hydroxy-3-phenylpropanamide |
|---|---|
| PubChem CID | 126601505 |
| Molecular Formula | C26H22N4O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 2-[3-(2-cyclopropylethynyl)-7-pyridin-4-ylindazol-2-yl]-N-hydroxy-3-phenylpropanamide |
| SMILES | O=C(NO)C(Cc1ccccc1)n1nc2c(-c3ccncc3)cccc2c1C#CC1CC1 |
| InChI | InChI=1S/C26H22N4O2/c31-26(29-32)24(17-19-5-2-1-3-6-19)30-23(12-11-18-9-10-18)22-8-4-7-21(25(22)28-30)20-13-15-27-16-14-20/h1-8,13-16,18,24,32H,9-10,17H2,(H,29,31) |
| InChIKey | NDSIQRFNFIYMSR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|